About 2-phenylsulfanylethyl 3-methyl-2-propan-2-ylbut-2-enoate
2-phenylsulfanylethyl 3-methyl-2-propan-2-ylbut-2-enoate (PubChem CID 70909259) has the molecular formula C16H22O2S
and a molecular weight of 278.42 g/mol. Its IUPAC name is 2-phenylsulfanylethyl 3-methyl-2-propan-2-ylbut-2-enoate.
Molecular Properties
| Compound Name | 2-phenylsulfanylethyl 3-methyl-2-propan-2-ylbut-2-enoate |
| PubChem CID | 70909259 |
| Molecular Formula | C16H22O2S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-phenylsulfanylethyl 3-methyl-2-propan-2-ylbut-2-enoate |
| SMILES | CC(C)=C(C(=O)OCCSc1ccccc1)C(C)C |
| InChI | InChI=1S/C16H22O2S/c1-12(2)15(13(3)4)16(17)18-10-11-19-14-8-6-5-7-9-14/h5-9,12H,10-11H2,1-4H3 |
| InChIKey | PRLFVTZCFCRPER-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylsulfanylethyl 3-methyl-2-propan-2-ylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylsulfanylethyl 3-methyl-2-propan-2-ylbut-2-enoate?
The IUPAC name of 2-phenylsulfanylethyl 3-methyl-2-propan-2-ylbut-2-enoate (CID 70909259) is 2-phenylsulfanylethyl 3-methyl-2-propan-2-ylbut-2-enoate.
What is the SMILES notation for 2-phenylsulfanylethyl 3-methyl-2-propan-2-ylbut-2-enoate?
The canonical SMILES for 2-phenylsulfanylethyl 3-methyl-2-propan-2-ylbut-2-enoate is CC(C)=C(C(=O)OCCSc1ccccc1)C(C)C.
What is the InChIKey of 2-phenylsulfanylethyl 3-methyl-2-propan-2-ylbut-2-enoate?
The InChIKey is PRLFVTZCFCRPER-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O2S/c1-12(2)15(13(3)4)16(17)18-10-11-19-14-8-6-5-7-9-14/h5-9,12H,10-11H2,1-4H3.
What are the key properties of 2-phenylsulfanylethyl 3-methyl-2-propan-2-ylbut-2-enoate?
2-phenylsulfanylethyl 3-methyl-2-propan-2-ylbut-2-enoate has a molecular weight of 278.42 g/mol, XLogP of 4.31, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylsulfanylethyl 3-methyl-2-propan-2-ylbut-2-enoate is sourced from PubChem (CID 70909259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).