C14H11ClN2OS — CID 70909626
(4-chlorophenyl)-(5-methylthieno[2,3-d]pyrimidin-4-yl)methanol (PubChem CID 70909626) has the molecular formula C14H11ClN2OS and a molecular weight of 290.78 g/mol. Its IUPAC name is (4-chlorophenyl)-(5-methylthieno[2,3-d]pyrimidin-4-yl)methanol.
| Compound Name | (4-chlorophenyl)-(5-methylthieno[2,3-d]pyrimidin-4-yl)methanol |
|---|---|
| PubChem CID | 70909626 |
| Molecular Formula | C14H11ClN2OS |
| Molecular Weight | 290.78 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | (4-chlorophenyl)-(5-methylthieno[2,3-d]pyrimidin-4-yl)methanol |
| SMILES | Cc1csc2ncnc(C(O)c3ccc(Cl)cc3)c12 |
| InChI | InChI=1S/C14H11ClN2OS/c1-8-6-19-14-11(8)12(16-7-17-14)13(18)9-2-4-10(15)5-3-9/h2-7,13,18H,1H3 |
| InChIKey | XTJZTURFBZCWMR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.78 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |