C16H20O2 — CID 70909815
1-(3-cyclohexa-1,5-dien-1-yloxypropoxy)-2-methylbenzene (PubChem CID 70909815) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is 1-(3-cyclohexa-1,5-dien-1-yloxypropoxy)-2-methylbenzene.
| Compound Name | 1-(3-cyclohexa-1,5-dien-1-yloxypropoxy)-2-methylbenzene |
|---|---|
| PubChem CID | 70909815 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 1-(3-cyclohexa-1,5-dien-1-yloxypropoxy)-2-methylbenzene |
| SMILES | Cc1ccccc1OCCCOC1=CCCC=C1 |
| InChI | InChI=1S/C16H20O2/c1-14-8-5-6-11-16(14)18-13-7-12-17-15-9-3-2-4-10-15/h3,5-6,8-11H,2,4,7,12-13H2,1H3 |
| InChIKey | HRVRPBQEGXJHGY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|