C23H31N5O3 — CID 70910084
1-[(Z)-6-amino-5-[2-[3-(cyclopropylmethoxy)phenyl]ethyl-(methylideneamino)amino]hex-5-enyl]pyrimidine-2,4-dione (PubChem CID 70910084) has the molecular formula C23H31N5O3 and a molecular weight of 425.53 g/mol. Its IUPAC name is 1-[(Z)-6-amino-5-[2-[3-(cyclopropylmethoxy)phenyl]ethyl-(methylideneamino)amino]hex-5-enyl]pyrimidine-2,4-dione.
| Compound Name | 1-[(Z)-6-amino-5-[2-[3-(cyclopropylmethoxy)phenyl]ethyl-(methylideneamino)amino]hex-5-enyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70910084 |
| Molecular Formula | C23H31N5O3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | 1-[(Z)-6-amino-5-[2-[3-(cyclopropylmethoxy)phenyl]ethyl-(methylideneamino)amino]hex-5-enyl]pyrimidine-2,4-dione |
| SMILES | C=NN(CCc1cccc(OCC2CC2)c1)/C(=C\N)CCCCn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C23H31N5O3/c1-25-28(14-10-18-5-4-7-21(15-18)31-17-19-8-9-19)20(16-24)6-2-3-12-27-13-11-22(29)26-23(27)30/h4-5,7,11,13,15-16,19H,1-3,6,8-10,12,14,17,24H2,(H,26,29,30)/b20-16- |
| InChIKey | SUXRCOQYHBSAFY-SILNSSARSA-N |
| XLogP | 2.46 |
| TPSA | 105.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|