C25H27N5O3 — CID 70910170
1-[4-[3-[(2S)-2-hydroxy-2-(2-phenylphenyl)propyl]triazol-4-yl]butyl]pyrimidine-2,4-dione (PubChem CID 70910170) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is 1-[4-[3-[(2S)-2-hydroxy-2-(2-phenylphenyl)propyl]triazol-4-yl]butyl]pyrimidine-2,4-dione.
| Compound Name | 1-[4-[3-[(2S)-2-hydroxy-2-(2-phenylphenyl)propyl]triazol-4-yl]butyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70910170 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 1-[4-[3-[(2S)-2-hydroxy-2-(2-phenylphenyl)propyl]triazol-4-yl]butyl]pyrimidine-2,4-dione |
| SMILES | C[C@@](O)(Cn1nncc1CCCCn1ccc(=O)[nH]c1=O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C25H27N5O3/c1-25(33,22-13-6-5-12-21(22)19-9-3-2-4-10-19)18-30-20(17-26-28-30)11-7-8-15-29-16-14-23(31)27-24(29)32/h2-6,9-10,12-14,16-17,33H,7-8,11,15,18H2,1H3,(H,27,31,32)/t25-/m1/s1 |
| InChIKey | PKFDLXNMTLJZKX-RUZDIDTESA-N |
| XLogP | 2.73 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|