C23H29N5O4 — CID 70910255
1-[4-[3-[(2S)-2-[2-(cyclopropylmethoxy)phenyl]-2-hydroxypropyl]triazol-4-yl]butyl]pyrimidine-2,4-dione (PubChem CID 70910255) has the molecular formula C23H29N5O4 and a molecular weight of 439.52 g/mol. Its IUPAC name is 1-[4-[3-[(2S)-2-[2-(cyclopropylmethoxy)phenyl]-2-hydroxypropyl]triazol-4-yl]butyl]pyrimidine-2,4-dione.
| Compound Name | 1-[4-[3-[(2S)-2-[2-(cyclopropylmethoxy)phenyl]-2-hydroxypropyl]triazol-4-yl]butyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70910255 |
| Molecular Formula | C23H29N5O4 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | 1-[4-[3-[(2S)-2-[2-(cyclopropylmethoxy)phenyl]-2-hydroxypropyl]triazol-4-yl]butyl]pyrimidine-2,4-dione |
| SMILES | C[C@@](O)(Cn1nncc1CCCCn1ccc(=O)[nH]c1=O)c1ccccc1OCC1CC1 |
| InChI | InChI=1S/C23H29N5O4/c1-23(31,19-7-2-3-8-20(19)32-15-17-9-10-17)16-28-18(14-24-26-28)6-4-5-12-27-13-11-21(29)25-22(27)30/h2-3,7-8,11,13-14,17,31H,4-6,9-10,12,15-16H2,1H3,(H,25,29,30)/t23-/m1/s1 |
| InChIKey | WXSBWTWBWBBTHP-HSZRJFAPSA-N |
| XLogP | 1.85 |
| TPSA | 115.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|