C20H35NO — CID 70910386
4-[(E)-1-aminododec-6-en-3-yl]-2,6-dimethylcyclohexa-1,5-dien-1-ol (PubChem CID 70910386) has the molecular formula C20H35NO and a molecular weight of 305.51 g/mol. Its IUPAC name is 4-[(E)-1-aminododec-6-en-3-yl]-2,6-dimethylcyclohexa-1,5-dien-1-ol.
| Compound Name | 4-[(E)-1-aminododec-6-en-3-yl]-2,6-dimethylcyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 70910386 |
| Molecular Formula | C20H35NO |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.27 |
| IUPAC Name | 4-[(E)-1-aminododec-6-en-3-yl]-2,6-dimethylcyclohexa-1,5-dien-1-ol |
| SMILES | CCCCC/C=C/CCC(CCN)C1C=C(C)C(O)=C(C)C1 |
| InChI | InChI=1S/C20H35NO/c1-4-5-6-7-8-9-10-11-18(12-13-21)19-14-16(2)20(22)17(3)15-19/h8-9,14,18-19,22H,4-7,10-13,15,21H2,1-3H3/b9-8+ |
| InChIKey | FMHBWSAGDWAANG-CMDGGOBGSA-N |
| XLogP | 5.67 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|