About 3-cyclopentyl-2-[(3,5-difluorophenyl)methoxy]-N-ethylpropanamide
3-cyclopentyl-2-[(3,5-difluorophenyl)methoxy]-N-ethylpropanamide (PubChem CID 70910539) has the molecular formula C17H23F2NO2
and a molecular weight of 311.37 g/mol. Its IUPAC name is 3-cyclopentyl-2-[(3,5-difluorophenyl)methoxy]-N-ethylpropanamide.
Molecular Properties
| Compound Name | 3-cyclopentyl-2-[(3,5-difluorophenyl)methoxy]-N-ethylpropanamide |
| PubChem CID | 70910539 |
| Molecular Formula | C17H23F2NO2 |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 3-cyclopentyl-2-[(3,5-difluorophenyl)methoxy]-N-ethylpropanamide |
| SMILES | CCNC(=O)C(CC1CCCC1)OCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C17H23F2NO2/c1-2-20-17(21)16(9-12-5-3-4-6-12)22-11-13-7-14(18)10-15(19)8-13/h7-8,10,12,16H,2-6,9,11H2,1H3,(H,20,21) |
| InChIKey | LZJZPCCTQGQMIV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclopentyl-2-[(3,5-difluorophenyl)methoxy]-N-ethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentyl-2-[(3,5-difluorophenyl)methoxy]-N-ethylpropanamide?
The IUPAC name of 3-cyclopentyl-2-[(3,5-difluorophenyl)methoxy]-N-ethylpropanamide (CID 70910539) is 3-cyclopentyl-2-[(3,5-difluorophenyl)methoxy]-N-ethylpropanamide.
What is the SMILES notation for 3-cyclopentyl-2-[(3,5-difluorophenyl)methoxy]-N-ethylpropanamide?
The canonical SMILES for 3-cyclopentyl-2-[(3,5-difluorophenyl)methoxy]-N-ethylpropanamide is CCNC(=O)C(CC1CCCC1)OCc1cc(F)cc(F)c1.
What is the InChIKey of 3-cyclopentyl-2-[(3,5-difluorophenyl)methoxy]-N-ethylpropanamide?
The InChIKey is LZJZPCCTQGQMIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23F2NO2/c1-2-20-17(21)16(9-12-5-3-4-6-12)22-11-13-7-14(18)10-15(19)8-13/h7-8,10,12,16H,2-6,9,11H2,1H3,(H,20,21).
What are the key properties of 3-cyclopentyl-2-[(3,5-difluorophenyl)methoxy]-N-ethylpropanamide?
3-cyclopentyl-2-[(3,5-difluorophenyl)methoxy]-N-ethylpropanamide has a molecular weight of 311.37 g/mol, XLogP of 3.57, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentyl-2-[(3,5-difluorophenyl)methoxy]-N-ethylpropanamide is sourced from PubChem (CID 70910539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).