C13H13F3N4O7S2 — CID 70910738
2-hydroxy-N,N-dimethyl-6-(trifluoromethyl)-3-[(1,1,3-trioxo-5-sulfamoyl-1,2-thiazol-4-yl)amino]benzamide (PubChem CID 70910738) has the molecular formula C13H13F3N4O7S2 and a molecular weight of 458.40 g/mol. Its IUPAC name is 2-hydroxy-N,N-dimethyl-6-(trifluoromethyl)-3-[(1,1,3-trioxo-5-sulfamoyl-1,2-thiazol-4-yl)amino]benzamide.
| Compound Name | 2-hydroxy-N,N-dimethyl-6-(trifluoromethyl)-3-[(1,1,3-trioxo-5-sulfamoyl-1,2-thiazol-4-yl)amino]benzamide |
|---|---|
| PubChem CID | 70910738 |
| Molecular Formula | C13H13F3N4O7S2 |
| Molecular Weight | 458.40 g/mol |
| Exact Mass | 458.02 |
| IUPAC Name | 2-hydroxy-N,N-dimethyl-6-(trifluoromethyl)-3-[(1,1,3-trioxo-5-sulfamoyl-1,2-thiazol-4-yl)amino]benzamide |
| SMILES | CN(C)C(=O)c1c(C(F)(F)F)ccc(NC2=C(S(N)(=O)=O)S(=O)(=O)NC2=O)c1O |
| InChI | InChI=1S/C13H13F3N4O7S2/c1-20(2)11(23)7-5(13(14,15)16)3-4-6(9(7)21)18-8-10(22)19-29(26,27)12(8)28(17,24)25/h3-4,18,21H,1-2H3,(H,19,22)(H2,17,24,25) |
| InChIKey | KYNJIJZYOJDUOW-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 175.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.40 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|