C23H24O3 — CID 70911528
(3R)-2-hydroxy-3-[4-(4-methylphenyl)cyclohexyl]-2,3-dihydronaphthalene-1,4-dione (PubChem CID 70911528) has the molecular formula C23H24O3 and a molecular weight of 348.44 g/mol. Its IUPAC name is (3R)-2-hydroxy-3-[4-(4-methylphenyl)cyclohexyl]-2,3-dihydronaphthalene-1,4-dione.
| Compound Name | (3R)-2-hydroxy-3-[4-(4-methylphenyl)cyclohexyl]-2,3-dihydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 70911528 |
| Molecular Formula | C23H24O3 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | (3R)-2-hydroxy-3-[4-(4-methylphenyl)cyclohexyl]-2,3-dihydronaphthalene-1,4-dione |
| SMILES | Cc1ccc(C2CCC([C@H]3C(=O)c4ccccc4C(=O)C3O)CC2)cc1 |
| InChI | InChI=1S/C23H24O3/c1-14-6-8-15(9-7-14)16-10-12-17(13-11-16)20-21(24)18-4-2-3-5-19(18)22(25)23(20)26/h2-9,16-17,20,23,26H,10-13H2,1H3/t16?,17?,20-,23?/m0/s1 |
| InChIKey | VYAOEDQJCOOHOU-MVBITHMVSA-N |
| XLogP | 4.33 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|