C16H17N3O5S2 — CID 70911759
5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-methyl-2-nitrothiophene-3-carboxamide (PubChem CID 70911759) has the molecular formula C16H17N3O5S2 and a molecular weight of 395.46 g/mol. Its IUPAC name is 5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-methyl-2-nitrothiophene-3-carboxamide.
| Compound Name | 5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-methyl-2-nitrothiophene-3-carboxamide |
|---|---|
| PubChem CID | 70911759 |
| Molecular Formula | C16H17N3O5S2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N-methyl-2-nitrothiophene-3-carboxamide |
| SMILES | CNC(=O)c1cc(-c2ccc(N3CCS(=O)(=O)CC3)cc2)sc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H17N3O5S2/c1-17-15(20)13-10-14(25-16(13)19(21)22)11-2-4-12(5-3-11)18-6-8-26(23,24)9-7-18/h2-5,10H,6-9H2,1H3,(H,17,20) |
| InChIKey | NEUDKLZRWANCMZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|