About benzyl-[2-[(2S,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]ethyl]azanium
benzyl-[2-[(2S,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]ethyl]azanium (PubChem CID 7091186) has the molecular formula C22H38NO+
and a molecular weight of 332.55 g/mol. Its IUPAC name is benzyl-[2-[(2S,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]ethyl]azanium.
Molecular Properties
| Compound Name | benzyl-[2-[(2S,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]ethyl]azanium |
| PubChem CID | 7091186 |
| Molecular Formula | C22H38NO+ |
| Molecular Weight | 332.55 g/mol |
| Exact Mass | 332.29 |
| IUPAC Name | benzyl-[2-[(2S,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]ethyl]azanium |
| SMILES | CC(C)CC[C@@]1(CC[NH2+]Cc2ccccc2)CCO[C@H](C(C)C)C1 |
| InChI | InChI=1S/C22H37NO/c1-18(2)10-11-22(13-15-24-21(16-22)19(3)4)12-14-23-17-20-8-6-5-7-9-20/h5-9,18-19,21,23H,10-17H2,1-4H3/p+1/t21-,22+/m0/s1 |
| InChIKey | TWEHSWBPHIACBO-FCHUYYIVSA-O |
| XLogP | 4.40 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.55 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze benzyl-[2-[(2S,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]ethyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl-[2-[(2S,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]ethyl]azanium?
The IUPAC name of benzyl-[2-[(2S,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]ethyl]azanium (CID 7091186) is benzyl-[2-[(2S,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]ethyl]azanium.
What is the SMILES notation for benzyl-[2-[(2S,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]ethyl]azanium?
The canonical SMILES for benzyl-[2-[(2S,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]ethyl]azanium is CC(C)CC[C@@]1(CC[NH2+]Cc2ccccc2)CCO[C@H](C(C)C)C1.
What is the InChIKey of benzyl-[2-[(2S,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]ethyl]azanium?
The InChIKey is TWEHSWBPHIACBO-FCHUYYIVSA-O. The full InChI is InChI=1S/C22H37NO/c1-18(2)10-11-22(13-15-24-21(16-22)19(3)4)12-14-23-17-20-8-6-5-7-9-20/h5-9,18-19,21,23H,10-17H2,1-4H3/p+1/t21-,22+/m0/s1.
What are the key properties of benzyl-[2-[(2S,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]ethyl]azanium?
benzyl-[2-[(2S,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]ethyl]azanium has a molecular weight of 332.55 g/mol, XLogP of 4.40, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl-[2-[(2S,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]ethyl]azanium is sourced from PubChem (CID 7091186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).