C28H40O19 — CID 70912081
[(3R,5R)-4,5-diacetyloxy-6-(2-hydroxyethoxy)-3-[(2R,3R,5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 70912081) has the molecular formula C28H40O19 and a molecular weight of 680.61 g/mol. Its IUPAC name is [(3R,5R)-4,5-diacetyloxy-6-(2-hydroxyethoxy)-3-[(2R,3R,5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(3R,5R)-4,5-diacetyloxy-6-(2-hydroxyethoxy)-3-[(2R,3R,5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 70912081 |
| Molecular Formula | C28H40O19 |
| Molecular Weight | 680.61 g/mol |
| Exact Mass | 680.22 |
| IUPAC Name | [(3R,5R)-4,5-diacetyloxy-6-(2-hydroxyethoxy)-3-[(2R,3R,5R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(OCCO)[C@H](OC(C)=O)C(OC(C)=O)[C@@H]1O[C@H]1OC(COC(C)=O)[C@@H](OC(C)=O)C(OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C28H40O19/c1-12(30)38-10-19-21(40-14(3)32)23(41-15(4)33)26(44-18(7)36)28(46-19)47-22-20(11-39-13(2)31)45-27(37-9-8-29)25(43-17(6)35)24(22)42-16(5)34/h19-29H,8-11H2,1-7H3/t19?,20?,21-,22-,23?,24?,25-,26-,27?,28-/m1/s1 |
| InChIKey | ANNSUPQTDOWOBF-TVYWOFAASA-N |
| XLogP | -1.38 |
| TPSA | 241.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.61 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|