C36H37FN6O3 — CID 70912709
11-(3-ethoxy-5-fluorophenyl)-8-ethyl-14-[(4-methoxyphenyl)methyl]-16-methyl-5-piperazin-1-yl-8,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-9-one (PubChem CID 70912709) has the molecular formula C36H37FN6O3 and a molecular weight of 620.73 g/mol. Its IUPAC name is 11-(3-ethoxy-5-fluorophenyl)-8-ethyl-14-[(4-methoxyphenyl)methyl]-16-methyl-5-piperazin-1-yl-8,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-9-one.
| Compound Name | 11-(3-ethoxy-5-fluorophenyl)-8-ethyl-14-[(4-methoxyphenyl)methyl]-16-methyl-5-piperazin-1-yl-8,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-9-one |
|---|---|
| PubChem CID | 70912709 |
| Molecular Formula | C36H37FN6O3 |
| Molecular Weight | 620.73 g/mol |
| Exact Mass | 620.29 |
| IUPAC Name | 11-(3-ethoxy-5-fluorophenyl)-8-ethyl-14-[(4-methoxyphenyl)methyl]-16-methyl-5-piperazin-1-yl-8,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-9-one |
| SMILES | CCOc1cc(F)cc(-c2nc3c(c(C)nn3Cc3ccc(OC)cc3)c3c2c(=O)n(CC)c2cc(N4CCNCC4)ccc32)c1 |
| InChI | InChI=1S/C36H37FN6O3/c1-5-42-30-20-26(41-15-13-38-14-16-41)9-12-29(30)32-31-22(3)40-43(21-23-7-10-27(45-4)11-8-23)35(31)39-34(33(32)36(42)44)24-17-25(37)19-28(18-24)46-6-2/h7-12,17-20,38H,5-6,13-16,21H2,1-4H3 |
| InChIKey | APRGSSXPYDQJTK-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 86.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.73 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|