About 3-(3,4-dihydrodibenzofuran-2-yl)-9-propan-2-yl-1,2-dihydrocarbazole
3-(3,4-dihydrodibenzofuran-2-yl)-9-propan-2-yl-1,2-dihydrocarbazole (PubChem CID 70912927) has the molecular formula C27H25NO
and a molecular weight of 379.50 g/mol. Its IUPAC name is 3-(3,4-dihydrodibenzofuran-2-yl)-9-propan-2-yl-1,2-dihydrocarbazole.
Molecular Properties
| Compound Name | 3-(3,4-dihydrodibenzofuran-2-yl)-9-propan-2-yl-1,2-dihydrocarbazole |
| PubChem CID | 70912927 |
| Molecular Formula | C27H25NO |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 3-(3,4-dihydrodibenzofuran-2-yl)-9-propan-2-yl-1,2-dihydrocarbazole |
| SMILES | CC(C)n1c2c(c3ccccc31)C=C(C1=Cc3c(oc4ccccc34)CC1)CC2 |
| InChI | InChI=1S/C27H25NO/c1-17(2)28-24-9-5-3-7-20(24)22-15-18(11-13-25(22)28)19-12-14-27-23(16-19)21-8-4-6-10-26(21)29-27/h3-10,15-17H,11-14H2,1-2H3 |
| InChIKey | JPTXJLGKAWWEGF-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3,4-dihydrodibenzofuran-2-yl)-9-propan-2-yl-1,2-dihydrocarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dihydrodibenzofuran-2-yl)-9-propan-2-yl-1,2-dihydrocarbazole?
The IUPAC name of 3-(3,4-dihydrodibenzofuran-2-yl)-9-propan-2-yl-1,2-dihydrocarbazole (CID 70912927) is 3-(3,4-dihydrodibenzofuran-2-yl)-9-propan-2-yl-1,2-dihydrocarbazole.
What is the SMILES notation for 3-(3,4-dihydrodibenzofuran-2-yl)-9-propan-2-yl-1,2-dihydrocarbazole?
The canonical SMILES for 3-(3,4-dihydrodibenzofuran-2-yl)-9-propan-2-yl-1,2-dihydrocarbazole is CC(C)n1c2c(c3ccccc31)C=C(C1=Cc3c(oc4ccccc34)CC1)CC2.
What is the InChIKey of 3-(3,4-dihydrodibenzofuran-2-yl)-9-propan-2-yl-1,2-dihydrocarbazole?
The InChIKey is JPTXJLGKAWWEGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25NO/c1-17(2)28-24-9-5-3-7-20(24)22-15-18(11-13-25(22)28)19-12-14-27-23(16-19)21-8-4-6-10-26(21)29-27/h3-10,15-17H,11-14H2,1-2H3.
What are the key properties of 3-(3,4-dihydrodibenzofuran-2-yl)-9-propan-2-yl-1,2-dihydrocarbazole?
3-(3,4-dihydrodibenzofuran-2-yl)-9-propan-2-yl-1,2-dihydrocarbazole has a molecular weight of 379.50 g/mol, XLogP of 7.33, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dihydrodibenzofuran-2-yl)-9-propan-2-yl-1,2-dihydrocarbazole is sourced from PubChem (CID 70912927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).