C22H28ClN3O2 — CID 70913078
5-chloro-3-[cyclohexyl(ethyl)amino]-2-methyl-N-[(2-oxo-1H-pyridin-3-yl)methyl]benzamide (PubChem CID 70913078) has the molecular formula C22H28ClN3O2 and a molecular weight of 401.94 g/mol. Its IUPAC name is 5-chloro-3-[cyclohexyl(ethyl)amino]-2-methyl-N-[(2-oxo-1H-pyridin-3-yl)methyl]benzamide.
| Compound Name | 5-chloro-3-[cyclohexyl(ethyl)amino]-2-methyl-N-[(2-oxo-1H-pyridin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 70913078 |
| Molecular Formula | C22H28ClN3O2 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 5-chloro-3-[cyclohexyl(ethyl)amino]-2-methyl-N-[(2-oxo-1H-pyridin-3-yl)methyl]benzamide |
| SMILES | CCN(c1cc(Cl)cc(C(=O)NCc2ccc[nH]c2=O)c1C)C1CCCCC1 |
| InChI | InChI=1S/C22H28ClN3O2/c1-3-26(18-9-5-4-6-10-18)20-13-17(23)12-19(15(20)2)22(28)25-14-16-8-7-11-24-21(16)27/h7-8,11-13,18H,3-6,9-10,14H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | WNVQSXAUIUABOQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |