C20H20ClN3O4 — CID 70913209
5-chloro-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-3-(2,5-dioxopyrrolidin-1-yl)-2-methylbenzamide (PubChem CID 70913209) has the molecular formula C20H20ClN3O4 and a molecular weight of 401.85 g/mol. Its IUPAC name is 5-chloro-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-3-(2,5-dioxopyrrolidin-1-yl)-2-methylbenzamide.
| Compound Name | 5-chloro-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-3-(2,5-dioxopyrrolidin-1-yl)-2-methylbenzamide |
|---|---|
| PubChem CID | 70913209 |
| Molecular Formula | C20H20ClN3O4 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 5-chloro-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-3-(2,5-dioxopyrrolidin-1-yl)-2-methylbenzamide |
| SMILES | Cc1cc(C)c(CNC(=O)c2cc(Cl)cc(N3C(=O)CCC3=O)c2C)c(=O)[nH]1 |
| InChI | InChI=1S/C20H20ClN3O4/c1-10-6-11(2)23-20(28)15(10)9-22-19(27)14-7-13(21)8-16(12(14)3)24-17(25)4-5-18(24)26/h6-8H,4-5,9H2,1-3H3,(H,22,27)(H,23,28) |
| InChIKey | RTIKXEJBUXGZML-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|