C14H24O4S2 — CID 70913743
(5R,6S)-1,4-bis(ethylsulfonyl)-2,3,5,6-tetramethylcyclohexa-1,3-diene (PubChem CID 70913743) has the molecular formula C14H24O4S2 and a molecular weight of 320.48 g/mol. Its IUPAC name is (5R,6S)-1,4-bis(ethylsulfonyl)-2,3,5,6-tetramethylcyclohexa-1,3-diene.
| Compound Name | (5R,6S)-1,4-bis(ethylsulfonyl)-2,3,5,6-tetramethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 70913743 |
| Molecular Formula | C14H24O4S2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | (5R,6S)-1,4-bis(ethylsulfonyl)-2,3,5,6-tetramethylcyclohexa-1,3-diene |
| SMILES | CCS(=O)(=O)C1=C(C)C(C)=C(S(=O)(=O)CC)[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C14H24O4S2/c1-7-19(15,16)13-9(3)11(5)14(12(6)10(13)4)20(17,18)8-2/h9,11H,7-8H2,1-6H3/t9-,11+ |
| InChIKey | JOIYLUWOORSDEJ-JGZJWPJOSA-N |
| XLogP | 2.69 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |