C19H21NO3S — CID 70914814
(12R)-12-methyl-1'-oxospiro[13-oxa-10-azatetracyclo[8.7.0.02,7.011,15]heptadeca-2,4,6,11(15)-tetraene-16,2'-thiolane]-14-one (PubChem CID 70914814) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is (12R)-12-methyl-1'-oxospiro[13-oxa-10-azatetracyclo[8.7.0.02,7.011,15]heptadeca-2,4,6,11(15)-tetraene-16,2'-thiolane]-14-one.
| Compound Name | (12R)-12-methyl-1'-oxospiro[13-oxa-10-azatetracyclo[8.7.0.02,7.011,15]heptadeca-2,4,6,11(15)-tetraene-16,2'-thiolane]-14-one |
|---|---|
| PubChem CID | 70914814 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | (12R)-12-methyl-1'-oxospiro[13-oxa-10-azatetracyclo[8.7.0.02,7.011,15]heptadeca-2,4,6,11(15)-tetraene-16,2'-thiolane]-14-one |
| SMILES | C[C@H]1OC(=O)C2=C1N1CCc3ccccc3C1CC21CCCS1=O |
| InChI | InChI=1S/C19H21NO3S/c1-12-17-16(18(21)23-12)19(8-4-10-24(19)22)11-15-14-6-3-2-5-13(14)7-9-20(15)17/h2-3,5-6,12,15H,4,7-11H2,1H3/t12-,15?,19?,24?/m1/s1 |
| InChIKey | MWGNUMNVUQCSQY-PILNCXGDSA-N |
| XLogP | 2.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |