C10H13N3O5 — CID 70915013
2-[[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]amino]acetic acid (PubChem CID 70915013) has the molecular formula C10H13N3O5 and a molecular weight of 255.23 g/mol. Its IUPAC name is 2-[[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]amino]acetic acid.
| Compound Name | 2-[[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]amino]acetic acid |
|---|---|
| PubChem CID | 70915013 |
| Molecular Formula | C10H13N3O5 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2-[[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]amino]acetic acid |
| SMILES | O=C(O)CNCC(=O)NCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H13N3O5/c14-7(5-11-6-10(17)18)12-3-4-13-8(15)1-2-9(13)16/h1-2,11H,3-6H2,(H,12,14)(H,17,18) |
| InChIKey | BBOQQRZHTHGQSZ-UHFFFAOYSA-N |
| XLogP | -2.30 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|