C21H32N6O2 — CID 70915068
cyclopentylmethyl 4-[3-(6-amino-9-methylpurin-2-yl)propyl]piperidine-1-carboxylate (PubChem CID 70915068) has the molecular formula C21H32N6O2 and a molecular weight of 400.53 g/mol. Its IUPAC name is cyclopentylmethyl 4-[3-(6-amino-9-methylpurin-2-yl)propyl]piperidine-1-carboxylate.
| Compound Name | cyclopentylmethyl 4-[3-(6-amino-9-methylpurin-2-yl)propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 70915068 |
| Molecular Formula | C21H32N6O2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | cyclopentylmethyl 4-[3-(6-amino-9-methylpurin-2-yl)propyl]piperidine-1-carboxylate |
| SMILES | Cn1cnc2c(N)nc(CCCC3CCN(C(=O)OCC4CCCC4)CC3)nc21 |
| InChI | InChI=1S/C21H32N6O2/c1-26-14-23-18-19(22)24-17(25-20(18)26)8-4-7-15-9-11-27(12-10-15)21(28)29-13-16-5-2-3-6-16/h14-16H,2-13H2,1H3,(H2,22,24,25) |
| InChIKey | SCCNMRBZYFSLNT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |