About 3-butyl-2-ethyl-1,3-thiazolidine-4-carboxylic acid
3-butyl-2-ethyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 70915112) has the molecular formula C10H19NO2S
and a molecular weight of 217.33 g/mol. Its IUPAC name is 3-butyl-2-ethyl-1,3-thiazolidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 3-butyl-2-ethyl-1,3-thiazolidine-4-carboxylic acid |
| PubChem CID | 70915112 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 3-butyl-2-ethyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CCCCN1C(CC)SCC1C(=O)O |
| InChI | InChI=1S/C10H19NO2S/c1-3-5-6-11-8(10(12)13)7-14-9(11)4-2/h8-9H,3-7H2,1-2H3,(H,12,13) |
| InChIKey | BKQGKHUBPYNYLC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-butyl-2-ethyl-1,3-thiazolidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-2-ethyl-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of 3-butyl-2-ethyl-1,3-thiazolidine-4-carboxylic acid (CID 70915112) is 3-butyl-2-ethyl-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for 3-butyl-2-ethyl-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for 3-butyl-2-ethyl-1,3-thiazolidine-4-carboxylic acid is CCCCN1C(CC)SCC1C(=O)O.
What is the InChIKey of 3-butyl-2-ethyl-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is BKQGKHUBPYNYLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2S/c1-3-5-6-11-8(10(12)13)7-14-9(11)4-2/h8-9H,3-7H2,1-2H3,(H,12,13).
What are the key properties of 3-butyl-2-ethyl-1,3-thiazolidine-4-carboxylic acid?
3-butyl-2-ethyl-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 217.33 g/mol, XLogP of 2.02, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-2-ethyl-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 70915112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).