C14H17F2N3 — CID 70915313
3-butan-2-yl-5-[1-(2,2-difluoroethyl)pyrazol-4-yl]pyridine (PubChem CID 70915313) has the molecular formula C14H17F2N3 and a molecular weight of 265.31 g/mol. Its IUPAC name is 3-butan-2-yl-5-[1-(2,2-difluoroethyl)pyrazol-4-yl]pyridine.
| Compound Name | 3-butan-2-yl-5-[1-(2,2-difluoroethyl)pyrazol-4-yl]pyridine |
|---|---|
| PubChem CID | 70915313 |
| Molecular Formula | C14H17F2N3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 3-butan-2-yl-5-[1-(2,2-difluoroethyl)pyrazol-4-yl]pyridine |
| SMILES | CCC(C)c1cncc(-c2cnn(CC(F)F)c2)c1 |
| InChI | InChI=1S/C14H17F2N3/c1-3-10(2)11-4-12(6-17-5-11)13-7-18-19(8-13)9-14(15)16/h4-8,10,14H,3,9H2,1-2H3 |
| InChIKey | IEOGXYJLDDZSFG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |