About 2,4-dimethoxy-6-(methoxymethyl)-3,6-dihydro-2H-pyran-3-ol
2,4-dimethoxy-6-(methoxymethyl)-3,6-dihydro-2H-pyran-3-ol (PubChem CID 70916063) has the molecular formula C9H16O5
and a molecular weight of 204.22 g/mol. Its IUPAC name is 2,4-dimethoxy-6-(methoxymethyl)-3,6-dihydro-2H-pyran-3-ol.
Molecular Properties
| Compound Name | 2,4-dimethoxy-6-(methoxymethyl)-3,6-dihydro-2H-pyran-3-ol |
| PubChem CID | 70916063 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 2,4-dimethoxy-6-(methoxymethyl)-3,6-dihydro-2H-pyran-3-ol |
| SMILES | COCC1C=C(OC)C(O)C(OC)O1 |
| InChI | InChI=1S/C9H16O5/c1-11-5-6-4-7(12-2)8(10)9(13-3)14-6/h4,6,8-10H,5H2,1-3H3 |
| InChIKey | UXNGPEMIZYAKRH-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,4-dimethoxy-6-(methoxymethyl)-3,6-dihydro-2H-pyran-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethoxy-6-(methoxymethyl)-3,6-dihydro-2H-pyran-3-ol?
The IUPAC name of 2,4-dimethoxy-6-(methoxymethyl)-3,6-dihydro-2H-pyran-3-ol (CID 70916063) is 2,4-dimethoxy-6-(methoxymethyl)-3,6-dihydro-2H-pyran-3-ol.
What is the SMILES notation for 2,4-dimethoxy-6-(methoxymethyl)-3,6-dihydro-2H-pyran-3-ol?
The canonical SMILES for 2,4-dimethoxy-6-(methoxymethyl)-3,6-dihydro-2H-pyran-3-ol is COCC1C=C(OC)C(O)C(OC)O1.
What is the InChIKey of 2,4-dimethoxy-6-(methoxymethyl)-3,6-dihydro-2H-pyran-3-ol?
The InChIKey is UXNGPEMIZYAKRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O5/c1-11-5-6-4-7(12-2)8(10)9(13-3)14-6/h4,6,8-10H,5H2,1-3H3.
What are the key properties of 2,4-dimethoxy-6-(methoxymethyl)-3,6-dihydro-2H-pyran-3-ol?
2,4-dimethoxy-6-(methoxymethyl)-3,6-dihydro-2H-pyran-3-ol has a molecular weight of 204.22 g/mol, XLogP of -0.10, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethoxy-6-(methoxymethyl)-3,6-dihydro-2H-pyran-3-ol is sourced from PubChem (CID 70916063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).