C12H12F3N3O3 — CID 70916079
(6-methyl-5-nitro-2-pyridinyl) (E)-4,4,4-trifluoro-N,3-dimethylbut-2-enimidate (PubChem CID 70916079) has the molecular formula C12H12F3N3O3 and a molecular weight of 303.24 g/mol. Its IUPAC name is (6-methyl-5-nitro-2-pyridinyl) (E)-4,4,4-trifluoro-N,3-dimethylbut-2-enimidate.
| Compound Name | (6-methyl-5-nitro-2-pyridinyl) (E)-4,4,4-trifluoro-N,3-dimethylbut-2-enimidate |
|---|---|
| PubChem CID | 70916079 |
| Molecular Formula | C12H12F3N3O3 |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | (6-methyl-5-nitro-2-pyridinyl) (E)-4,4,4-trifluoro-N,3-dimethylbut-2-enimidate |
| SMILES | C/N=C(\C=C(/C)C(F)(F)F)Oc1ccc([N+](=O)[O-])c(C)n1 |
| InChI | InChI=1S/C12H12F3N3O3/c1-7(12(13,14)15)6-11(16-3)21-10-5-4-9(18(19)20)8(2)17-10/h4-6H,1-3H3/b7-6+,16-11+ |
| InChIKey | MTVJYWBMOJQSOQ-NHTOTWMQSA-N |
| XLogP | 3.21 |
| TPSA | 77.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|