C27H32N2O4S — CID 70916315
methyl 5-butoxy-17-cyclohexyl-8-methyl-9-oxo-15-thia-8,11-diazatetracyclo[9.6.0.02,7.012,16]heptadeca-1(17),2(7),3,5,12(16),13-hexaene-14-carboxylate (PubChem CID 70916315) has the molecular formula C27H32N2O4S and a molecular weight of 480.63 g/mol. Its IUPAC name is methyl 5-butoxy-17-cyclohexyl-8-methyl-9-oxo-15-thia-8,11-diazatetracyclo[9.6.0.02,7.012,16]heptadeca-1(17),2(7),3,5,12(16),13-hexaene-14-carboxylate.
| Compound Name | methyl 5-butoxy-17-cyclohexyl-8-methyl-9-oxo-15-thia-8,11-diazatetracyclo[9.6.0.02,7.012,16]heptadeca-1(17),2(7),3,5,12(16),13-hexaene-14-carboxylate |
|---|---|
| PubChem CID | 70916315 |
| Molecular Formula | C27H32N2O4S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | methyl 5-butoxy-17-cyclohexyl-8-methyl-9-oxo-15-thia-8,11-diazatetracyclo[9.6.0.02,7.012,16]heptadeca-1(17),2(7),3,5,12(16),13-hexaene-14-carboxylate |
| SMILES | CCCCOc1ccc2c(c1)N(C)C(=O)Cn1c-2c(C2CCCCC2)c2sc(C(=O)OC)cc21 |
| InChI | InChI=1S/C27H32N2O4S/c1-4-5-13-33-18-11-12-19-20(14-18)28(2)23(30)16-29-21-15-22(27(31)32-3)34-26(21)24(25(19)29)17-9-7-6-8-10-17/h11-12,14-15,17H,4-10,13,16H2,1-3H3 |
| InChIKey | CWGVZCHHMKOIAK-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|