C11H11FNO3S- — CID 70916923
4-[(4S,5R)-4-(fluoromethyl)-2-methyl-4,5-dihydro-1,3-oxazol-5-yl]benzenesulfinate (PubChem CID 70916923) has the molecular formula C11H11FNO3S- and a molecular weight of 256.28 g/mol. Its IUPAC name is 4-[(4S,5R)-4-(fluoromethyl)-2-methyl-4,5-dihydro-1,3-oxazol-5-yl]benzenesulfinate.
| Compound Name | 4-[(4S,5R)-4-(fluoromethyl)-2-methyl-4,5-dihydro-1,3-oxazol-5-yl]benzenesulfinate |
|---|---|
| PubChem CID | 70916923 |
| Molecular Formula | C11H11FNO3S- |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 4-[(4S,5R)-4-(fluoromethyl)-2-methyl-4,5-dihydro-1,3-oxazol-5-yl]benzenesulfinate |
| SMILES | CC1=N[C@H](CF)[C@@H](c2ccc(S(=O)[O-])cc2)O1 |
| InChI | InChI=1S/C11H12FNO3S/c1-7-13-10(6-12)11(16-7)8-2-4-9(5-3-8)17(14)15/h2-5,10-11H,6H2,1H3,(H,14,15)/p-1/t10-,11-/m1/s1 |
| InChIKey | ZEPMFTKPLJDQTL-GHMZBOCLSA-M |
| XLogP | 1.75 |
| TPSA | 61.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|