C12H18N2S — CID 70916934
5-(5-methylthiophen-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridine (PubChem CID 70916934) has the molecular formula C12H18N2S and a molecular weight of 222.36 g/mol. Its IUPAC name is 5-(5-methylthiophen-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 5-(5-methylthiophen-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 70916934 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 5-(5-methylthiophen-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Cc1ccc(C2CNC3NCCC3C2)s1 |
| InChI | InChI=1S/C12H18N2S/c1-8-2-3-11(15-8)10-6-9-4-5-13-12(9)14-7-10/h2-3,9-10,12-14H,4-7H2,1H3 |
| InChIKey | CSLMWYCQVQNXHJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |