C20H34O4 — CID 70917092
2,3-dimethoxy-5-methyl-6-[(E)-2,5,7-trimethyloct-4-en-2-yl]cyclohexa-2,5-diene-1,4-diol (PubChem CID 70917092) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is 2,3-dimethoxy-5-methyl-6-[(E)-2,5,7-trimethyloct-4-en-2-yl]cyclohexa-2,5-diene-1,4-diol.
| Compound Name | 2,3-dimethoxy-5-methyl-6-[(E)-2,5,7-trimethyloct-4-en-2-yl]cyclohexa-2,5-diene-1,4-diol |
|---|---|
| PubChem CID | 70917092 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 2,3-dimethoxy-5-methyl-6-[(E)-2,5,7-trimethyloct-4-en-2-yl]cyclohexa-2,5-diene-1,4-diol |
| SMILES | COC1=C(OC)C(O)C(C(C)(C)C/C=C(\C)CC(C)C)=C(C)C1O |
| InChI | InChI=1S/C20H34O4/c1-12(2)11-13(3)9-10-20(5,6)15-14(4)16(21)18(23-7)19(24-8)17(15)22/h9,12,16-17,21-22H,10-11H2,1-8H3/b13-9+ |
| InChIKey | ZSFKGZDDUOIXBQ-UKTHLTGXSA-N |
| XLogP | 3.95 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|