C22H25BrN4O2 — CID 70917182
2-[(Z)-(4-bromo-2-oxo-1H-indol-3-ylidene)methyl]-5-[2-(ethylamino)ethyl]-3-methyl-1,6,7,8-tetrahydropyrrolo[3,2-c]azepin-4-one (PubChem CID 70917182) has the molecular formula C22H25BrN4O2 and a molecular weight of 457.37 g/mol. Its IUPAC name is 2-[(Z)-(4-bromo-2-oxo-1H-indol-3-ylidene)methyl]-5-[2-(ethylamino)ethyl]-3-methyl-1,6,7,8-tetrahydropyrrolo[3,2-c]azepin-4-one.
| Compound Name | 2-[(Z)-(4-bromo-2-oxo-1H-indol-3-ylidene)methyl]-5-[2-(ethylamino)ethyl]-3-methyl-1,6,7,8-tetrahydropyrrolo[3,2-c]azepin-4-one |
|---|---|
| PubChem CID | 70917182 |
| Molecular Formula | C22H25BrN4O2 |
| Molecular Weight | 457.37 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 2-[(Z)-(4-bromo-2-oxo-1H-indol-3-ylidene)methyl]-5-[2-(ethylamino)ethyl]-3-methyl-1,6,7,8-tetrahydropyrrolo[3,2-c]azepin-4-one |
| SMILES | CCNCCN1CCCc2[nH]c(/C=C3\C(=O)Nc4cccc(Br)c43)c(C)c2C1=O |
| InChI | InChI=1S/C22H25BrN4O2/c1-3-24-9-11-27-10-5-8-16-19(22(27)29)13(2)18(25-16)12-14-20-15(23)6-4-7-17(20)26-21(14)28/h4,6-7,12,24-25H,3,5,8-11H2,1-2H3,(H,26,28)/b14-12- |
| InChIKey | ZKQMIKTZLWDQQZ-OWBHPGMISA-N |
| XLogP | 3.58 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|