About lawrencium;1-methyl-5-phenyl-3-propyl-1,2,4-triazole
lawrencium;1-methyl-5-phenyl-3-propyl-1,2,4-triazole (PubChem CID 70917337) has the molecular formula C12H14LrN3-
and a molecular weight of 462.27 g/mol. Its IUPAC name is lawrencium;1-methyl-5-phenyl-3-propyl-1,2,4-triazole.
Molecular Properties
| Compound Name | lawrencium;1-methyl-5-phenyl-3-propyl-1,2,4-triazole |
| PubChem CID | 70917337 |
| Molecular Formula | C12H14LrN3- |
| Molecular Weight | 462.27 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | lawrencium;1-methyl-5-phenyl-3-propyl-1,2,4-triazole |
| SMILES | CCCc1nc(-c2[c-]cccc2)n(C)n1.[Lr] |
| InChI | InChI=1S/C12H14N3.Lr/c1-3-7-11-13-12(15(2)14-11)10-8-5-4-6-9-10;/h4-6,8H,3,7H2,1-2H3;/q-1; |
| InChIKey | FLVDSPAVVMVBSH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lawrencium;1-methyl-5-phenyl-3-propyl-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lawrencium;1-methyl-5-phenyl-3-propyl-1,2,4-triazole?
The IUPAC name of lawrencium;1-methyl-5-phenyl-3-propyl-1,2,4-triazole (CID 70917337) is lawrencium;1-methyl-5-phenyl-3-propyl-1,2,4-triazole.
What is the SMILES notation for lawrencium;1-methyl-5-phenyl-3-propyl-1,2,4-triazole?
The canonical SMILES for lawrencium;1-methyl-5-phenyl-3-propyl-1,2,4-triazole is CCCc1nc(-c2[c-]cccc2)n(C)n1.[Lr].
What is the InChIKey of lawrencium;1-methyl-5-phenyl-3-propyl-1,2,4-triazole?
The InChIKey is FLVDSPAVVMVBSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N3.Lr/c1-3-7-11-13-12(15(2)14-11)10-8-5-4-6-9-10;/h4-6,8H,3,7H2,1-2H3;/q-1;.
What are the key properties of lawrencium;1-methyl-5-phenyl-3-propyl-1,2,4-triazole?
lawrencium;1-methyl-5-phenyl-3-propyl-1,2,4-triazole has a molecular weight of 462.27 g/mol, XLogP of 2.23, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lawrencium;1-methyl-5-phenyl-3-propyl-1,2,4-triazole is sourced from PubChem (CID 70917337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).