C18H16F3N3O4 — CID 70917391
5-[(3aR,4S,5S,7S,7aS)-5-methoxy-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile (PubChem CID 70917391) has the molecular formula C18H16F3N3O4 and a molecular weight of 395.34 g/mol. Its IUPAC name is 5-[(3aR,4S,5S,7S,7aS)-5-methoxy-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile.
| Compound Name | 5-[(3aR,4S,5S,7S,7aS)-5-methoxy-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 70917391 |
| Molecular Formula | C18H16F3N3O4 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 5-[(3aR,4S,5S,7S,7aS)-5-methoxy-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-3-(trifluoromethyl)pyridine-2-carbonitrile |
| SMILES | CO[C@H]1C[C@]2(C)O[C@@]1(C)[C@@H]1C(=O)N(c3cnc(C#N)c(C(F)(F)F)c3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C18H16F3N3O4/c1-16-5-11(27-3)17(2,28-16)13-12(16)14(25)24(15(13)26)8-4-9(18(19,20)21)10(6-22)23-7-8/h4,7,11-13H,5H2,1-3H3/t11-,12+,13-,16-,17+/m0/s1 |
| InChIKey | OAPQXSTWXUPQEN-LKFLVWNSSA-N |
| XLogP | 2.04 |
| TPSA | 92.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|