C18H19N3O4 — CID 70917538
5-[(3aR,4S,5S,7aS)-5-hydroxy-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-3,4-dimethylpyridine-2-carbonitrile (PubChem CID 70917538) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 5-[(3aR,4S,5S,7aS)-5-hydroxy-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-3,4-dimethylpyridine-2-carbonitrile.
| Compound Name | 5-[(3aR,4S,5S,7aS)-5-hydroxy-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-3,4-dimethylpyridine-2-carbonitrile |
|---|---|
| PubChem CID | 70917538 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 5-[(3aR,4S,5S,7aS)-5-hydroxy-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-3,4-dimethylpyridine-2-carbonitrile |
| SMILES | Cc1c(N2C(=O)[C@@H]3[C@H](C2=O)C2(C)C[C@H](O)[C@@]3(C)O2)cnc(C#N)c1C |
| InChI | InChI=1S/C18H19N3O4/c1-8-9(2)11(7-20-10(8)6-19)21-15(23)13-14(16(21)24)18(4)12(22)5-17(13,3)25-18/h7,12-14,22H,5H2,1-4H3/t12-,13+,14-,17?,18+/m0/s1 |
| InChIKey | FOYKSVCGTLZRBO-DGYCUNQMSA-N |
| XLogP | 0.99 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|