C31H28N4O4 — CID 70917571
4-[(3aS,4R,7R,7aR)-4-methyl-1,3-dioxo-7-[2-[(2-phenyl-3,4-dihydropyrazol-5-yl)oxy]ethyl]-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile (PubChem CID 70917571) has the molecular formula C31H28N4O4 and a molecular weight of 520.59 g/mol. Its IUPAC name is 4-[(3aS,4R,7R,7aR)-4-methyl-1,3-dioxo-7-[2-[(2-phenyl-3,4-dihydropyrazol-5-yl)oxy]ethyl]-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile.
| Compound Name | 4-[(3aS,4R,7R,7aR)-4-methyl-1,3-dioxo-7-[2-[(2-phenyl-3,4-dihydropyrazol-5-yl)oxy]ethyl]-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 70917571 |
| Molecular Formula | C31H28N4O4 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | 4-[(3aS,4R,7R,7aR)-4-methyl-1,3-dioxo-7-[2-[(2-phenyl-3,4-dihydropyrazol-5-yl)oxy]ethyl]-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
| SMILES | C[C@]12CC[C@](CCOC3=NN(c4ccccc4)CC3)(O1)[C@@H]1C(=O)N(c3ccc(C#N)c4ccccc34)C(=O)[C@@H]12 |
| InChI | InChI=1S/C31H28N4O4/c1-30-14-15-31(39-30,16-18-38-25-13-17-34(33-25)21-7-3-2-4-8-21)27-26(30)28(36)35(29(27)37)24-12-11-20(19-32)22-9-5-6-10-23(22)24/h2-12,26-27H,13-18H2,1H3/t26-,27+,30-,31-/m1/s1 |
| InChIKey | MTRXIYYJNIAZEP-QGBBYCRPSA-N |
| XLogP | 4.77 |
| TPSA | 95.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|