About 4-[3,5-di(indol-1-yl)phenyl]heptan-4-amine
4-[3,5-di(indol-1-yl)phenyl]heptan-4-amine (PubChem CID 70917805) has the molecular formula C29H31N3
and a molecular weight of 421.59 g/mol. Its IUPAC name is 4-[3,5-di(indol-1-yl)phenyl]heptan-4-amine.
Molecular Properties
| Compound Name | 4-[3,5-di(indol-1-yl)phenyl]heptan-4-amine |
| PubChem CID | 70917805 |
| Molecular Formula | C29H31N3 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | 4-[3,5-di(indol-1-yl)phenyl]heptan-4-amine |
| SMILES | CCCC(N)(CCC)c1cc(-n2ccc3ccccc32)cc(-n2ccc3ccccc32)c1 |
| InChI | InChI=1S/C29H31N3/c1-3-15-29(30,16-4-2)24-19-25(31-17-13-22-9-5-7-11-27(22)31)21-26(20-24)32-18-14-23-10-6-8-12-28(23)32/h5-14,17-21H,3-4,15-16,30H2,1-2H3 |
| InChIKey | WDFXNCHDRQHIEE-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[3,5-di(indol-1-yl)phenyl]heptan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3,5-di(indol-1-yl)phenyl]heptan-4-amine?
The IUPAC name of 4-[3,5-di(indol-1-yl)phenyl]heptan-4-amine (CID 70917805) is 4-[3,5-di(indol-1-yl)phenyl]heptan-4-amine.
What is the SMILES notation for 4-[3,5-di(indol-1-yl)phenyl]heptan-4-amine?
The canonical SMILES for 4-[3,5-di(indol-1-yl)phenyl]heptan-4-amine is CCCC(N)(CCC)c1cc(-n2ccc3ccccc32)cc(-n2ccc3ccccc32)c1.
What is the InChIKey of 4-[3,5-di(indol-1-yl)phenyl]heptan-4-amine?
The InChIKey is WDFXNCHDRQHIEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H31N3/c1-3-15-29(30,16-4-2)24-19-25(31-17-13-22-9-5-7-11-27(22)31)21-26(20-24)32-18-14-23-10-6-8-12-28(23)32/h5-14,17-21H,3-4,15-16,30H2,1-2H3.
What are the key properties of 4-[3,5-di(indol-1-yl)phenyl]heptan-4-amine?
4-[3,5-di(indol-1-yl)phenyl]heptan-4-amine has a molecular weight of 421.59 g/mol, XLogP of 7.33, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,5-di(indol-1-yl)phenyl]heptan-4-amine is sourced from PubChem (CID 70917805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).