About 6-(2-aminopropyl)-2,3-dihydronaphthalen-2-ol
6-(2-aminopropyl)-2,3-dihydronaphthalen-2-ol (PubChem CID 70917876) has the molecular formula C13H17NO
and a molecular weight of 203.28 g/mol. Its IUPAC name is 6-(2-aminopropyl)-2,3-dihydronaphthalen-2-ol.
Molecular Properties
| Compound Name | 6-(2-aminopropyl)-2,3-dihydronaphthalen-2-ol |
| PubChem CID | 70917876 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 6-(2-aminopropyl)-2,3-dihydronaphthalen-2-ol |
| SMILES | CC(N)Cc1ccc2c(c1)=CCC(O)C=2 |
| InChI | InChI=1S/C13H17NO/c1-9(14)6-10-2-3-12-8-13(15)5-4-11(12)7-10/h2-4,7-9,13,15H,5-6,14H2,1H3 |
| InChIKey | OZYQKJAUFKURCT-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(2-aminopropyl)-2,3-dihydronaphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-aminopropyl)-2,3-dihydronaphthalen-2-ol?
The IUPAC name of 6-(2-aminopropyl)-2,3-dihydronaphthalen-2-ol (CID 70917876) is 6-(2-aminopropyl)-2,3-dihydronaphthalen-2-ol.
What is the SMILES notation for 6-(2-aminopropyl)-2,3-dihydronaphthalen-2-ol?
The canonical SMILES for 6-(2-aminopropyl)-2,3-dihydronaphthalen-2-ol is CC(N)Cc1ccc2c(c1)=CCC(O)C=2.
What is the InChIKey of 6-(2-aminopropyl)-2,3-dihydronaphthalen-2-ol?
The InChIKey is OZYQKJAUFKURCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO/c1-9(14)6-10-2-3-12-8-13(15)5-4-11(12)7-10/h2-4,7-9,13,15H,5-6,14H2,1H3.
What are the key properties of 6-(2-aminopropyl)-2,3-dihydronaphthalen-2-ol?
6-(2-aminopropyl)-2,3-dihydronaphthalen-2-ol has a molecular weight of 203.28 g/mol, XLogP of -0.10, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-aminopropyl)-2,3-dihydronaphthalen-2-ol is sourced from PubChem (CID 70917876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).