About 2-chloro-1-[(5S)-4,5-dimethyl-5-pentan-2-ylcyclopenten-1-yl]benzimidazole
2-chloro-1-[(5S)-4,5-dimethyl-5-pentan-2-ylcyclopenten-1-yl]benzimidazole (PubChem CID 70918322) has the molecular formula C19H25ClN2
and a molecular weight of 316.88 g/mol. Its IUPAC name is 2-chloro-1-[(5S)-4,5-dimethyl-5-pentan-2-ylcyclopenten-1-yl]benzimidazole.
Molecular Properties
| Compound Name | 2-chloro-1-[(5S)-4,5-dimethyl-5-pentan-2-ylcyclopenten-1-yl]benzimidazole |
| PubChem CID | 70918322 |
| Molecular Formula | C19H25ClN2 |
| Molecular Weight | 316.88 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 2-chloro-1-[(5S)-4,5-dimethyl-5-pentan-2-ylcyclopenten-1-yl]benzimidazole |
| SMILES | CCCC(C)[C@]1(C)C(n2c(Cl)nc3ccccc32)=CCC1C |
| InChI | InChI=1S/C19H25ClN2/c1-5-8-13(2)19(4)14(3)11-12-17(19)22-16-10-7-6-9-15(16)21-18(22)20/h6-7,9-10,12-14H,5,8,11H2,1-4H3/t13?,14?,19-/m0/s1 |
| InChIKey | RJRQHICUJOJQBQ-MHVYXZCWSA-N |
| XLogP | 6.01 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.88 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-1-[(5S)-4,5-dimethyl-5-pentan-2-ylcyclopenten-1-yl]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1-[(5S)-4,5-dimethyl-5-pentan-2-ylcyclopenten-1-yl]benzimidazole?
The IUPAC name of 2-chloro-1-[(5S)-4,5-dimethyl-5-pentan-2-ylcyclopenten-1-yl]benzimidazole (CID 70918322) is 2-chloro-1-[(5S)-4,5-dimethyl-5-pentan-2-ylcyclopenten-1-yl]benzimidazole.
What is the SMILES notation for 2-chloro-1-[(5S)-4,5-dimethyl-5-pentan-2-ylcyclopenten-1-yl]benzimidazole?
The canonical SMILES for 2-chloro-1-[(5S)-4,5-dimethyl-5-pentan-2-ylcyclopenten-1-yl]benzimidazole is CCCC(C)[C@]1(C)C(n2c(Cl)nc3ccccc32)=CCC1C.
What is the InChIKey of 2-chloro-1-[(5S)-4,5-dimethyl-5-pentan-2-ylcyclopenten-1-yl]benzimidazole?
The InChIKey is RJRQHICUJOJQBQ-MHVYXZCWSA-N. The full InChI is InChI=1S/C19H25ClN2/c1-5-8-13(2)19(4)14(3)11-12-17(19)22-16-10-7-6-9-15(16)21-18(22)20/h6-7,9-10,12-14H,5,8,11H2,1-4H3/t13?,14?,19-/m0/s1.
What are the key properties of 2-chloro-1-[(5S)-4,5-dimethyl-5-pentan-2-ylcyclopenten-1-yl]benzimidazole?
2-chloro-1-[(5S)-4,5-dimethyl-5-pentan-2-ylcyclopenten-1-yl]benzimidazole has a molecular weight of 316.88 g/mol, XLogP of 6.01, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1-[(5S)-4,5-dimethyl-5-pentan-2-ylcyclopenten-1-yl]benzimidazole is sourced from PubChem (CID 70918322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).