C22H30O2S — CID 70918893
ethyl (Z)-2-ethylsulfanyl-6-(3-methylspiro[5.5]undeca-1,4,7,10-tetraen-3-yl)hex-5-enoate (PubChem CID 70918893) has the molecular formula C22H30O2S and a molecular weight of 358.55 g/mol. Its IUPAC name is ethyl (Z)-2-ethylsulfanyl-6-(3-methylspiro[5.5]undeca-1,4,7,10-tetraen-3-yl)hex-5-enoate.
| Compound Name | ethyl (Z)-2-ethylsulfanyl-6-(3-methylspiro[5.5]undeca-1,4,7,10-tetraen-3-yl)hex-5-enoate |
|---|---|
| PubChem CID | 70918893 |
| Molecular Formula | C22H30O2S |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | ethyl (Z)-2-ethylsulfanyl-6-(3-methylspiro[5.5]undeca-1,4,7,10-tetraen-3-yl)hex-5-enoate |
| SMILES | CCOC(=O)C(CC/C=C\C1(C)C=CC2(C=CCC=C2)C=C1)SCC |
| InChI | InChI=1S/C22H30O2S/c1-4-24-20(23)19(25-5-2)11-7-10-12-21(3)15-17-22(18-16-21)13-8-6-9-14-22/h8-10,12-19H,4-7,11H2,1-3H3/b12-10- |
| InChIKey | KEJQSXOZKAYFCR-BENRWUELSA-N |
| XLogP | 5.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|