C20H16ClF2N3O — CID 70919152
5-chloro-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-1H-indole-2-carboxamide (PubChem CID 70919152) has the molecular formula C20H16ClF2N3O and a molecular weight of 387.82 g/mol. Its IUPAC name is 5-chloro-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 70919152 |
| Molecular Formula | C20H16ClF2N3O |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 5-chloro-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-1H-indole-2-carboxamide |
| SMILES | Cc1[nH]c2c(F)cc(F)cc2c1CCNC(=O)c1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C20H16ClF2N3O/c1-10-14(15-8-13(22)9-16(23)19(15)25-10)4-5-24-20(27)18-7-11-6-12(21)2-3-17(11)26-18/h2-3,6-9,25-26H,4-5H2,1H3,(H,24,27) |
| InChIKey | CMRIXWMNQCLIMQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|