C25H33FN2O4 — CID 70919276
(4R)-3-[(3S,4R)-1-tert-butyl-4-(6-fluoro-4-hydroxycyclohexa-2,4-dien-1-yl)pyrrolidine-3-carbonyl]-4-(cyclohexa-2,4-dien-1-ylmethyl)-1,3-oxazolidin-2-one (PubChem CID 70919276) has the molecular formula C25H33FN2O4 and a molecular weight of 444.55 g/mol. Its IUPAC name is (4R)-3-[(3S,4R)-1-tert-butyl-4-(6-fluoro-4-hydroxycyclohexa-2,4-dien-1-yl)pyrrolidine-3-carbonyl]-4-(cyclohexa-2,4-dien-1-ylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(3S,4R)-1-tert-butyl-4-(6-fluoro-4-hydroxycyclohexa-2,4-dien-1-yl)pyrrolidine-3-carbonyl]-4-(cyclohexa-2,4-dien-1-ylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 70919276 |
| Molecular Formula | C25H33FN2O4 |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | (4R)-3-[(3S,4R)-1-tert-butyl-4-(6-fluoro-4-hydroxycyclohexa-2,4-dien-1-yl)pyrrolidine-3-carbonyl]-4-(cyclohexa-2,4-dien-1-ylmethyl)-1,3-oxazolidin-2-one |
| SMILES | CC(C)(C)N1C[C@@H](C(=O)N2C(=O)OC[C@H]2CC2C=CC=CC2)[C@H](C2C=CC(O)=CC2F)C1 |
| InChI | InChI=1S/C25H33FN2O4/c1-25(2,3)27-13-20(19-10-9-18(29)12-22(19)26)21(14-27)23(30)28-17(15-32-24(28)31)11-16-7-5-4-6-8-16/h4-7,9-10,12,16-17,19-22,29H,8,11,13-15H2,1-3H3/t16?,17-,19?,20+,21-,22?/m1/s1 |
| InChIKey | MVKRKKWHLSZMMZ-GSJLBCDKSA-N |
| XLogP | 4.17 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |