C26H29N5O4S — CID 70919410
(1R,2S,3R,5R)-3-[[5-(1,3-benzothiazol-2-yl)-6-ethyl-2-(2-methoxyanilino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 70919410) has the molecular formula C26H29N5O4S and a molecular weight of 507.62 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[[5-(1,3-benzothiazol-2-yl)-6-ethyl-2-(2-methoxyanilino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[[5-(1,3-benzothiazol-2-yl)-6-ethyl-2-(2-methoxyanilino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 70919410 |
| Molecular Formula | C26H29N5O4S |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | (1R,2S,3R,5R)-3-[[5-(1,3-benzothiazol-2-yl)-6-ethyl-2-(2-methoxyanilino)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | CCc1nc(Nc2ccccc2OC)nc(N[C@@H]2C[C@H](CO)[C@@H](O)[C@H]2O)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C26H29N5O4S/c1-3-15-21(25-28-17-9-5-7-11-20(17)36-25)24(27-18-12-14(13-32)22(33)23(18)34)31-26(29-15)30-16-8-4-6-10-19(16)35-2/h4-11,14,18,22-23,32-34H,3,12-13H2,1-2H3,(H2,27,29,30,31)/t14-,18-,22-,23+/m1/s1 |
| InChIKey | LMUXCFBHFHKDKY-XBRCYRKVSA-N |
| XLogP | 3.58 |
| TPSA | 132.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |