C24H30F3N5O3 — CID 70919413
[(1S,2S,3R,4R)-4-[[2-(2-methoxyethylamino)-6-methyl-5-[5-(trifluoromethyl)furo[2,3-c]pyridin-2-yl]pyrimidin-4-yl]amino]-2,3-dimethylcyclopentyl]methanol (PubChem CID 70919413) has the molecular formula C24H30F3N5O3 and a molecular weight of 493.53 g/mol. Its IUPAC name is [(1S,2S,3R,4R)-4-[[2-(2-methoxyethylamino)-6-methyl-5-[5-(trifluoromethyl)furo[2,3-c]pyridin-2-yl]pyrimidin-4-yl]amino]-2,3-dimethylcyclopentyl]methanol.
| Compound Name | [(1S,2S,3R,4R)-4-[[2-(2-methoxyethylamino)-6-methyl-5-[5-(trifluoromethyl)furo[2,3-c]pyridin-2-yl]pyrimidin-4-yl]amino]-2,3-dimethylcyclopentyl]methanol |
|---|---|
| PubChem CID | 70919413 |
| Molecular Formula | C24H30F3N5O3 |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | [(1S,2S,3R,4R)-4-[[2-(2-methoxyethylamino)-6-methyl-5-[5-(trifluoromethyl)furo[2,3-c]pyridin-2-yl]pyrimidin-4-yl]amino]-2,3-dimethylcyclopentyl]methanol |
| SMILES | COCCNc1nc(C)c(-c2cc3cc(C(F)(F)F)ncc3o2)c(N[C@@H]2C[C@H](CO)[C@@H](C)[C@H]2C)n1 |
| InChI | InChI=1S/C24H30F3N5O3/c1-12-13(2)17(7-16(12)11-33)31-22-21(14(3)30-23(32-22)28-5-6-34-4)18-8-15-9-20(24(25,26)27)29-10-19(15)35-18/h8-10,12-13,16-17,33H,5-7,11H2,1-4H3,(H2,28,30,31,32)/t12-,13+,16+,17+/m0/s1 |
| InChIKey | QKOXXNDUGBBDEA-NSNWQYSKSA-N |
| XLogP | 4.74 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|