About 4-[2-[(2-ethylpyrazol-3-yl)amino]-2-oxoethyl]-2-methyl-1,3-thiazole-5-carboxylic acid
4-[2-[(2-ethylpyrazol-3-yl)amino]-2-oxoethyl]-2-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 70919702) has the molecular formula C12H14N4O3S
and a molecular weight of 294.34 g/mol. Its IUPAC name is 4-[2-[(2-ethylpyrazol-3-yl)amino]-2-oxoethyl]-2-methyl-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-[2-[(2-ethylpyrazol-3-yl)amino]-2-oxoethyl]-2-methyl-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 70919702 |
| Molecular Formula | C12H14N4O3S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 4-[2-[(2-ethylpyrazol-3-yl)amino]-2-oxoethyl]-2-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | CCn1nccc1NC(=O)Cc1nc(C)sc1C(=O)O |
| InChI | InChI=1S/C12H14N4O3S/c1-3-16-9(4-5-13-16)15-10(17)6-8-11(12(18)19)20-7(2)14-8/h4-5H,3,6H2,1-2H3,(H,15,17)(H,18,19) |
| InChIKey | ZNLMDWYQUFNYCV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[2-[(2-ethylpyrazol-3-yl)amino]-2-oxoethyl]-2-methyl-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(2-ethylpyrazol-3-yl)amino]-2-oxoethyl]-2-methyl-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 4-[2-[(2-ethylpyrazol-3-yl)amino]-2-oxoethyl]-2-methyl-1,3-thiazole-5-carboxylic acid (CID 70919702) is 4-[2-[(2-ethylpyrazol-3-yl)amino]-2-oxoethyl]-2-methyl-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-[2-[(2-ethylpyrazol-3-yl)amino]-2-oxoethyl]-2-methyl-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 4-[2-[(2-ethylpyrazol-3-yl)amino]-2-oxoethyl]-2-methyl-1,3-thiazole-5-carboxylic acid is CCn1nccc1NC(=O)Cc1nc(C)sc1C(=O)O.
What is the InChIKey of 4-[2-[(2-ethylpyrazol-3-yl)amino]-2-oxoethyl]-2-methyl-1,3-thiazole-5-carboxylic acid?
The InChIKey is ZNLMDWYQUFNYCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O3S/c1-3-16-9(4-5-13-16)15-10(17)6-8-11(12(18)19)20-7(2)14-8/h4-5H,3,6H2,1-2H3,(H,15,17)(H,18,19).
What are the key properties of 4-[2-[(2-ethylpyrazol-3-yl)amino]-2-oxoethyl]-2-methyl-1,3-thiazole-5-carboxylic acid?
4-[2-[(2-ethylpyrazol-3-yl)amino]-2-oxoethyl]-2-methyl-1,3-thiazole-5-carboxylic acid has a molecular weight of 294.34 g/mol, XLogP of 1.55, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(2-ethylpyrazol-3-yl)amino]-2-oxoethyl]-2-methyl-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 70919702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).