About [(3R)-3-(dimethylamino)pyrrolidin-1-yl]-[(4R)-4-methylcyclohexa-1,5-dien-1-yl]methanone
[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-[(4R)-4-methylcyclohexa-1,5-dien-1-yl]methanone (PubChem CID 70919834) has the molecular formula C14H22N2O
and a molecular weight of 234.34 g/mol. Its IUPAC name is [(3R)-3-(dimethylamino)pyrrolidin-1-yl]-[(4R)-4-methylcyclohexa-1,5-dien-1-yl]methanone.
Molecular Properties
| Compound Name | [(3R)-3-(dimethylamino)pyrrolidin-1-yl]-[(4R)-4-methylcyclohexa-1,5-dien-1-yl]methanone |
| PubChem CID | 70919834 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | [(3R)-3-(dimethylamino)pyrrolidin-1-yl]-[(4R)-4-methylcyclohexa-1,5-dien-1-yl]methanone |
| SMILES | C[C@H]1C=CC(C(=O)N2CC[C@@H](N(C)C)C2)=CC1 |
| InChI | InChI=1S/C14H22N2O/c1-11-4-6-12(7-5-11)14(17)16-9-8-13(10-16)15(2)3/h4,6-7,11,13H,5,8-10H2,1-3H3/t11-,13+/m0/s1 |
| InChIKey | MNAFHHWFRKUYOW-WCQYABFASA-N |
| XLogP | 1.67 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(3R)-3-(dimethylamino)pyrrolidin-1-yl]-[(4R)-4-methylcyclohexa-1,5-dien-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-3-(dimethylamino)pyrrolidin-1-yl]-[(4R)-4-methylcyclohexa-1,5-dien-1-yl]methanone?
The IUPAC name of [(3R)-3-(dimethylamino)pyrrolidin-1-yl]-[(4R)-4-methylcyclohexa-1,5-dien-1-yl]methanone (CID 70919834) is [(3R)-3-(dimethylamino)pyrrolidin-1-yl]-[(4R)-4-methylcyclohexa-1,5-dien-1-yl]methanone.
What is the SMILES notation for [(3R)-3-(dimethylamino)pyrrolidin-1-yl]-[(4R)-4-methylcyclohexa-1,5-dien-1-yl]methanone?
The canonical SMILES for [(3R)-3-(dimethylamino)pyrrolidin-1-yl]-[(4R)-4-methylcyclohexa-1,5-dien-1-yl]methanone is C[C@H]1C=CC(C(=O)N2CC[C@@H](N(C)C)C2)=CC1.
What is the InChIKey of [(3R)-3-(dimethylamino)pyrrolidin-1-yl]-[(4R)-4-methylcyclohexa-1,5-dien-1-yl]methanone?
The InChIKey is MNAFHHWFRKUYOW-WCQYABFASA-N. The full InChI is InChI=1S/C14H22N2O/c1-11-4-6-12(7-5-11)14(17)16-9-8-13(10-16)15(2)3/h4,6-7,11,13H,5,8-10H2,1-3H3/t11-,13+/m0/s1.
What are the key properties of [(3R)-3-(dimethylamino)pyrrolidin-1-yl]-[(4R)-4-methylcyclohexa-1,5-dien-1-yl]methanone?
[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-[(4R)-4-methylcyclohexa-1,5-dien-1-yl]methanone has a molecular weight of 234.34 g/mol, XLogP of 1.67, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-3-(dimethylamino)pyrrolidin-1-yl]-[(4R)-4-methylcyclohexa-1,5-dien-1-yl]methanone is sourced from PubChem (CID 70919834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).