C19H30O2 — CID 70920301
8-butyl-2-cyclohex-3-en-1-yl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-one (PubChem CID 70920301) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 8-butyl-2-cyclohex-3-en-1-yl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-one.
| Compound Name | 8-butyl-2-cyclohex-3-en-1-yl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-one |
|---|---|
| PubChem CID | 70920301 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 8-butyl-2-cyclohex-3-en-1-yl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-one |
| SMILES | CCCCC1CCCC2C(=O)CC(C3CC=CCC3)OC12 |
| InChI | InChI=1S/C19H30O2/c1-2-3-8-15-11-7-12-16-17(20)13-18(21-19(15)16)14-9-5-4-6-10-14/h4-5,14-16,18-19H,2-3,6-13H2,1H3 |
| InChIKey | FEQBPURSXYVPCY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|