C19H35NO14 — CID 70920345
2-[[(3R,4R)-2,3,5,6-tetrahydroxy-4-[[(2R,4R,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methoxymethyl]hexanoyl]amino]ethyl 2-hydroxypropanoate (PubChem CID 70920345) has the molecular formula C19H35NO14 and a molecular weight of 501.48 g/mol. Its IUPAC name is 2-[[(3R,4R)-2,3,5,6-tetrahydroxy-4-[[(2R,4R,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methoxymethyl]hexanoyl]amino]ethyl 2-hydroxypropanoate.
| Compound Name | 2-[[(3R,4R)-2,3,5,6-tetrahydroxy-4-[[(2R,4R,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methoxymethyl]hexanoyl]amino]ethyl 2-hydroxypropanoate |
|---|---|
| PubChem CID | 70920345 |
| Molecular Formula | C19H35NO14 |
| Molecular Weight | 501.48 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | 2-[[(3R,4R)-2,3,5,6-tetrahydroxy-4-[[(2R,4R,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methoxymethyl]hexanoyl]amino]ethyl 2-hydroxypropanoate |
| SMILES | CC(O)C(=O)OCCNC(=O)C(O)[C@H](O)[C@H](COC[C@H]1OC(CO)[C@H](O)[C@@H](O)C1O)C(O)CO |
| InChI | InChI=1S/C19H35NO14/c1-8(23)19(31)33-3-2-20-18(30)17(29)13(25)9(10(24)4-21)6-32-7-12-15(27)16(28)14(26)11(5-22)34-12/h8-17,21-29H,2-7H2,1H3,(H,20,30)/t8?,9-,10?,11?,12-,13-,14+,15?,16-,17?/m1/s1 |
| InChIKey | UFEYJEQSTLBQHG-IZURYZNVSA-N |
| XLogP | -6.42 |
| TPSA | 255.93 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.48 |
| LogP ≤ 5 | -6.42 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|