C18H18N2O4 — CID 70920652
5-cyclohexa-1,3-dien-1-yl-1-(methoxymethyl)-5-phenyl-1,3-diazinane-2,4,6-trione (PubChem CID 70920652) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 5-cyclohexa-1,3-dien-1-yl-1-(methoxymethyl)-5-phenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-cyclohexa-1,3-dien-1-yl-1-(methoxymethyl)-5-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 70920652 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 5-cyclohexa-1,3-dien-1-yl-1-(methoxymethyl)-5-phenyl-1,3-diazinane-2,4,6-trione |
| SMILES | COCN1C(=O)NC(=O)C(C2=CC=CCC2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C18H18N2O4/c1-24-12-20-16(22)18(15(21)19-17(20)23,13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-6,8-10H,7,11-12H2,1H3,(H,19,21,23) |
| InChIKey | UMRXYVQNWVYTQY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|