C27H42N2O — CID 70920845
(4Z,7Z,10Z,13Z,16Z,19Z)-1-(4-methylpiperazin-1-yl)docosa-4,7,10,13,16,19-hexaen-1-one (PubChem CID 70920845) has the molecular formula C27H42N2O and a molecular weight of 410.65 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,16Z,19Z)-1-(4-methylpiperazin-1-yl)docosa-4,7,10,13,16,19-hexaen-1-one.
| Compound Name | (4Z,7Z,10Z,13Z,16Z,19Z)-1-(4-methylpiperazin-1-yl)docosa-4,7,10,13,16,19-hexaen-1-one |
|---|---|
| PubChem CID | 70920845 |
| Molecular Formula | C27H42N2O |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 410.33 |
| IUPAC Name | (4Z,7Z,10Z,13Z,16Z,19Z)-1-(4-methylpiperazin-1-yl)docosa-4,7,10,13,16,19-hexaen-1-one |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C27H42N2O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-27(30)29-25-23-28(2)24-26-29/h4-5,7-8,10-11,13-14,16-17,19-20H,3,6,9,12,15,18,21-26H2,1-2H3/b5-4-,8-7-,11-10-,14-13-,17-16-,20-19- |
| InChIKey | DSEVKWGWIFILPO-JDPCYWKWSA-N |
| XLogP | 6.24 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|