About 1-(3,4-dichlorophenyl)-3-[6-fluoro-1-(4-hydroxycyclohexyl)benzimidazol-2-yl]urea
1-(3,4-dichlorophenyl)-3-[6-fluoro-1-(4-hydroxycyclohexyl)benzimidazol-2-yl]urea (PubChem CID 70921230) has the molecular formula C20H19Cl2FN4O2
and a molecular weight of 437.30 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[6-fluoro-1-(4-hydroxycyclohexyl)benzimidazol-2-yl]urea.
Molecular Properties
| Compound Name | 1-(3,4-dichlorophenyl)-3-[6-fluoro-1-(4-hydroxycyclohexyl)benzimidazol-2-yl]urea |
| PubChem CID | 70921230 |
| Molecular Formula | C20H19Cl2FN4O2 |
| Molecular Weight | 437.30 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[6-fluoro-1-(4-hydroxycyclohexyl)benzimidazol-2-yl]urea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)Nc1nc2ccc(F)cc2n1C1CCC(O)CC1 |
| InChI | InChI=1S/C20H19Cl2FN4O2/c21-15-7-2-12(10-16(15)22)24-20(29)26-19-25-17-8-1-11(23)9-18(17)27(19)13-3-5-14(28)6-4-13/h1-2,7-10,13-14,28H,3-6H2,(H2,24,25,26,29) |
| InChIKey | HAOMTBLVRLDJAX-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.30 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3,4-dichlorophenyl)-3-[6-fluoro-1-(4-hydroxycyclohexyl)benzimidazol-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dichlorophenyl)-3-[6-fluoro-1-(4-hydroxycyclohexyl)benzimidazol-2-yl]urea?
The IUPAC name of 1-(3,4-dichlorophenyl)-3-[6-fluoro-1-(4-hydroxycyclohexyl)benzimidazol-2-yl]urea (CID 70921230) is 1-(3,4-dichlorophenyl)-3-[6-fluoro-1-(4-hydroxycyclohexyl)benzimidazol-2-yl]urea.
What is the SMILES notation for 1-(3,4-dichlorophenyl)-3-[6-fluoro-1-(4-hydroxycyclohexyl)benzimidazol-2-yl]urea?
The canonical SMILES for 1-(3,4-dichlorophenyl)-3-[6-fluoro-1-(4-hydroxycyclohexyl)benzimidazol-2-yl]urea is O=C(Nc1ccc(Cl)c(Cl)c1)Nc1nc2ccc(F)cc2n1C1CCC(O)CC1.
What is the InChIKey of 1-(3,4-dichlorophenyl)-3-[6-fluoro-1-(4-hydroxycyclohexyl)benzimidazol-2-yl]urea?
The InChIKey is HAOMTBLVRLDJAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19Cl2FN4O2/c21-15-7-2-12(10-16(15)22)24-20(29)26-19-25-17-8-1-11(23)9-18(17)27(19)13-3-5-14(28)6-4-13/h1-2,7-10,13-14,28H,3-6H2,(H2,24,25,26,29).
What are the key properties of 1-(3,4-dichlorophenyl)-3-[6-fluoro-1-(4-hydroxycyclohexyl)benzimidazol-2-yl]urea?
1-(3,4-dichlorophenyl)-3-[6-fluoro-1-(4-hydroxycyclohexyl)benzimidazol-2-yl]urea has a molecular weight of 437.30 g/mol, XLogP of 5.60, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dichlorophenyl)-3-[6-fluoro-1-(4-hydroxycyclohexyl)benzimidazol-2-yl]urea is sourced from PubChem (CID 70921230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).