C21H25N — CID 70921626
1-(3,3-diphenylprop-2-enyl)-4-methylpiperidine (PubChem CID 70921626) has the molecular formula C21H25N and a molecular weight of 291.44 g/mol. Its IUPAC name is 1-(3,3-diphenylprop-2-enyl)-4-methylpiperidine.
| Compound Name | 1-(3,3-diphenylprop-2-enyl)-4-methylpiperidine |
|---|---|
| PubChem CID | 70921626 |
| Molecular Formula | C21H25N |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 1-(3,3-diphenylprop-2-enyl)-4-methylpiperidine |
| SMILES | CC1CCN(CC=C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H25N/c1-18-12-15-22(16-13-18)17-14-21(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-11,14,18H,12-13,15-17H2,1H3 |
| InChIKey | PRNHRJPJWCZMQL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |